C35H51NO2 — CID 67323557
2-[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl]isoindole-1,3-dione (PubChem CID 67323557) has the molecular formula C35H51NO2 and a molecular weight of 517.80 g/mol. Its IUPAC name is 2-[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl]isoindole-1,3-dione.
| Compound Name | 2-[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67323557 |
| Molecular Formula | C35H51NO2 |
| Molecular Weight | 517.80 g/mol |
| Exact Mass | 517.39 |
| IUPAC Name | 2-[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl]isoindole-1,3-dione |
| SMILES | CC(CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C35H51NO2/c1-23(22-36-32(37)26-13-5-6-14-27(26)33(36)38)10-9-11-24(2)29-17-18-30-28-16-15-25-12-7-8-20-34(25,3)31(28)19-21-35(29,30)4/h5-6,13-14,23-25,28-31H,7-12,15-22H2,1-4H3/t23?,24-,25?,28+,29-,30+,31+,34+,35-/m1/s1 |
| InChIKey | NEPWUMNLGFUXDT-ILTFLWOPSA-N |
| XLogP | 8.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.80 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|