C34H54N2O2 — CID 141161560
3,5-diamino-2-[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl]benzoic acid (PubChem CID 141161560) has the molecular formula C34H54N2O2 and a molecular weight of 522.82 g/mol. Its IUPAC name is 3,5-diamino-2-[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl]benzoic acid.
| Compound Name | 3,5-diamino-2-[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl]benzoic acid |
|---|---|
| PubChem CID | 141161560 |
| Molecular Formula | C34H54N2O2 |
| Molecular Weight | 522.82 g/mol |
| Exact Mass | 522.42 |
| IUPAC Name | 3,5-diamino-2-[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl]benzoic acid |
| SMILES | CC(CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C)Cc1c(N)cc(N)cc1C(=O)O |
| InChI | InChI=1S/C34H54N2O2/c1-21(18-26-27(32(37)38)19-24(35)20-31(26)36)8-7-9-22(2)28-13-14-29-25-12-11-23-10-5-6-16-33(23,3)30(25)15-17-34(28,29)4/h19-23,25,28-30H,5-18,35-36H2,1-4H3,(H,37,38)/t21?,22-,23?,25+,28-,29+,30+,33+,34-/m1/s1 |
| InChIKey | WZURHYSSBMWJPT-FBEKVJLKSA-N |
| XLogP | 8.58 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.82 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|