C34H54N2O — CID 141204689
5-[[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-1-enoxy]methyl]benzene-1,3-diamine (PubChem CID 141204689) has the molecular formula C34H54N2O and a molecular weight of 506.82 g/mol. Its IUPAC name is 5-[[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-1-enoxy]methyl]benzene-1,3-diamine.
| Compound Name | 5-[[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-1-enoxy]methyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 141204689 |
| Molecular Formula | C34H54N2O |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 506.42 |
| IUPAC Name | 5-[[(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-1-enoxy]methyl]benzene-1,3-diamine |
| SMILES | CC(=COCc1cc(N)cc(N)c1)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H54N2O/c1-23(21-37-22-25-18-27(35)20-28(36)19-25)8-7-9-24(2)30-13-14-31-29-12-11-26-10-5-6-16-33(26,3)32(29)15-17-34(30,31)4/h18-21,24,26,29-32H,5-17,22,35-36H2,1-4H3/t24-,26?,29+,30-,31+,32+,33+,34-/m1/s1 |
| InChIKey | PYHAZXCRSNFQAA-AVKLKLAHSA-N |
| XLogP | 9.13 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|