C35H54N2O2 — CID 144748571
[6,11-dimethyl-5-(6-methylhept-5-en-2-yl)-14-tetracyclo[8.8.0.02,6.011,16]octadecanyl] 3,5-diaminobenzoate (PubChem CID 144748571) has the molecular formula C35H54N2O2 and a molecular weight of 534.83 g/mol. Its IUPAC name is [6,11-dimethyl-5-(6-methylhept-5-en-2-yl)-14-tetracyclo[8.8.0.02,6.011,16]octadecanyl] 3,5-diaminobenzoate.
| Compound Name | [6,11-dimethyl-5-(6-methylhept-5-en-2-yl)-14-tetracyclo[8.8.0.02,6.011,16]octadecanyl] 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 144748571 |
| Molecular Formula | C35H54N2O2 |
| Molecular Weight | 534.83 g/mol |
| Exact Mass | 534.42 |
| IUPAC Name | [6,11-dimethyl-5-(6-methylhept-5-en-2-yl)-14-tetracyclo[8.8.0.02,6.011,16]octadecanyl] 3,5-diaminobenzoate |
| SMILES | CC(C)=CCCC(C)C1CCC2C3CCC4CC(OC(=O)c5cc(N)cc(N)c5)CCC4(C)C3CCCC12C |
| InChI | InChI=1S/C35H54N2O2/c1-22(2)8-6-9-23(3)30-13-14-32-29-12-11-25-20-28(39-33(38)24-18-26(36)21-27(37)19-24)15-17-34(25,4)31(29)10-7-16-35(30,32)5/h8,18-19,21,23,25,28-32H,6-7,9-17,20,36-37H2,1-5H3 |
| InChIKey | NVCRCVYVZZOSMR-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.83 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|