C34H56N2O — CID 144734184
ethane;4-[[4-methyl-5-(6-methylhept-5-en-2-yl)-14-tetracyclo[7.7.1.01,12.04,8]heptadecanyl]oxy]benzene-1,3-diamine (PubChem CID 144734184) has the molecular formula C34H56N2O and a molecular weight of 508.84 g/mol. Its IUPAC name is ethane;4-[[4-methyl-5-(6-methylhept-5-en-2-yl)-14-tetracyclo[7.7.1.01,12.04,8]heptadecanyl]oxy]benzene-1,3-diamine.
| Compound Name | ethane;4-[[4-methyl-5-(6-methylhept-5-en-2-yl)-14-tetracyclo[7.7.1.01,12.04,8]heptadecanyl]oxy]benzene-1,3-diamine |
|---|---|
| PubChem CID | 144734184 |
| Molecular Formula | C34H56N2O |
| Molecular Weight | 508.84 g/mol |
| Exact Mass | 508.44 |
| IUPAC Name | ethane;4-[[4-methyl-5-(6-methylhept-5-en-2-yl)-14-tetracyclo[7.7.1.01,12.04,8]heptadecanyl]oxy]benzene-1,3-diamine |
| SMILES | CC.CC(C)=CCCC(C)C1CCC2C3CCC4CC(Oc5ccc(N)cc5N)CCC4(CCC12C)C3 |
| InChI | InChI=1S/C32H50N2O.C2H6/c1-21(2)6-5-7-22(3)27-11-12-28-23-8-9-24-18-26(35-30-13-10-25(33)19-29(30)34)14-15-32(24,20-23)17-16-31(27,28)4;1-2/h6,10,13,19,22-24,26-28H,5,7-9,11-12,14-18,20,33-34H2,1-4H3;1-2H3 |
| InChIKey | KYASYHJZGNUKRD-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.84 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|