C34H56N2O — CID 159177811
(3E,5Z)-6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]hepta-1,3,5-triene-3,5-diamine (PubChem CID 159177811) has the molecular formula C34H56N2O and a molecular weight of 508.84 g/mol. Its IUPAC name is (3E,5Z)-6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]hepta-1,3,5-triene-3,5-diamine.
| Compound Name | (3E,5Z)-6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]hepta-1,3,5-triene-3,5-diamine |
|---|---|
| PubChem CID | 159177811 |
| Molecular Formula | C34H56N2O |
| Molecular Weight | 508.84 g/mol |
| Exact Mass | 508.44 |
| IUPAC Name | (3E,5Z)-6-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]hepta-1,3,5-triene-3,5-diamine |
| SMILES | C=C/C(N)=C\C(N)=C(/C)OC1CCC2(C)C(C=CC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C34H56N2O/c1-8-26(35)21-32(36)24(5)37-27-16-18-33(6)25(20-27)12-13-28-30-15-14-29(23(4)11-9-10-22(2)3)34(30,7)19-17-31(28)33/h8,12-13,21-23,25,27-31H,1,9-11,14-20,35-36H2,2-7H3/b26-21+,32-24- |
| InChIKey | KMMRRBQMLNLSEU-ABVWEFCXSA-N |
| XLogP | 8.49 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.84 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|