C30H50O3 — CID 144848827
methyl [(8S,9R,10R,13S,14R,17S)-10,13,14-trimethyl-17-[(2S)-6-methylheptan-2-yl]-1,2,3,4,5,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] carbonate (PubChem CID 144848827) has the molecular formula C30H50O3 and a molecular weight of 458.73 g/mol. Its IUPAC name is methyl [(8S,9R,10R,13S,14R,17S)-10,13,14-trimethyl-17-[(2S)-6-methylheptan-2-yl]-1,2,3,4,5,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] carbonate.
| Compound Name | methyl [(8S,9R,10R,13S,14R,17S)-10,13,14-trimethyl-17-[(2S)-6-methylheptan-2-yl]-1,2,3,4,5,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] carbonate |
|---|---|
| PubChem CID | 144848827 |
| Molecular Formula | C30H50O3 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 458.38 |
| IUPAC Name | methyl [(8S,9R,10R,13S,14R,17S)-10,13,14-trimethyl-17-[(2S)-6-methylheptan-2-yl]-1,2,3,4,5,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] carbonate |
| SMILES | COC(=O)OC1CC[C@]2(C)C(C=C[C@H]3[C@H]2CC[C@@]2(C)[C@H]([C@@H](C)CCCC(C)C)CC[C@]32C)C1 |
| InChI | InChI=1S/C30H50O3/c1-20(2)9-8-10-21(3)24-14-17-30(6)26-12-11-22-19-23(33-27(31)32-7)13-16-28(22,4)25(26)15-18-29(24,30)5/h11-12,20-26H,8-10,13-19H2,1-7H3/t21-,22?,23?,24-,25+,26-,28+,29-,30+/m0/s1 |
| InChIKey | IDEIJSVKBCDZDK-RYQQDYDZSA-N |
| XLogP | 8.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|