C29H49NO2 — CID 58789992
[(3S,10S,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-methylcarbamate (PubChem CID 58789992) has the molecular formula C29H49NO2 and a molecular weight of 443.72 g/mol. Its IUPAC name is [(3S,10S,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-methylcarbamate.
| Compound Name | [(3S,10S,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 58789992 |
| Molecular Formula | C29H49NO2 |
| Molecular Weight | 443.72 g/mol |
| Exact Mass | 443.38 |
| IUPAC Name | [(3S,10S,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-methylcarbamate |
| SMILES | CNC(=O)O[C@H]1CC[C@@]2(C)C(C=CC3C4CCC(C(C)CCCC(C)C)[C@@]4(C)CCC32)C1 |
| InChI | InChI=1S/C29H49NO2/c1-19(2)8-7-9-20(3)24-12-13-25-23-11-10-21-18-22(32-27(31)30-6)14-16-28(21,4)26(23)15-17-29(24,25)5/h10-11,19-26H,7-9,12-18H2,1-6H3,(H,30,31)/t20?,21?,22-,23?,24?,25?,26?,28-,29+/m0/s1 |
| InChIKey | QRXQORDHAQKHCI-AVWGNXKESA-N |
| XLogP | 7.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.72 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|