C31H55NO3 — CID 99572818
2-[[(3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl N-methylcarbamate (PubChem CID 99572818) has the molecular formula C31H55NO3 and a molecular weight of 489.79 g/mol. Its IUPAC name is 2-[[(3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl N-methylcarbamate.
| Compound Name | 2-[[(3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl N-methylcarbamate |
|---|---|
| PubChem CID | 99572818 |
| Molecular Formula | C31H55NO3 |
| Molecular Weight | 489.79 g/mol |
| Exact Mass | 489.42 |
| IUPAC Name | 2-[[(3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl N-methylcarbamate |
| SMILES | CNC(=O)OCCO[C@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@@H](C)CCCC(C)C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C31H55NO3/c1-21(2)8-7-9-22(3)26-12-13-27-25-11-10-23-20-24(34-18-19-35-29(33)32-6)14-16-30(23,4)28(25)15-17-31(26,27)5/h21-28H,7-20H2,1-6H3,(H,32,33)/t22-,23-,24-,25-,26+,27-,28-,30-,31+/m0/s1 |
| InChIKey | FFPJXROPWLFEGB-HMJHITTHSA-N |
| XLogP | 7.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.79 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|