C32H60O2 — CID 142066865
3-[[10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propan-1-ol;ethane (PubChem CID 142066865) has the molecular formula C32H60O2 and a molecular weight of 476.83 g/mol. Its IUPAC name is 3-[[10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propan-1-ol;ethane.
| Compound Name | 3-[[10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propan-1-ol;ethane |
|---|---|
| PubChem CID | 142066865 |
| Molecular Formula | C32H60O2 |
| Molecular Weight | 476.83 g/mol |
| Exact Mass | 476.46 |
| IUPAC Name | 3-[[10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propan-1-ol;ethane |
| SMILES | CC.CC(C)CCC[C@@H](C)C1CCC2C3CCC4CC(OCCCO)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C30H54O2.C2H6/c1-21(2)8-6-9-22(3)26-12-13-27-25-11-10-23-20-24(32-19-7-18-31)14-16-29(23,4)28(25)15-17-30(26,27)5;1-2/h21-28,31H,6-20H2,1-5H3;1-2H3/t22-,23?,24?,25?,26?,27?,28?,29?,30?;/m1./s1 |
| InChIKey | OMYKXAMXUZEUSM-YEPCWUHMSA-N |
| XLogP | 8.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.83 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|