C32H57NO3 — CID 99575529
2-[[(3R,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl N-ethylcarbamate (PubChem CID 99575529) has the molecular formula C32H57NO3 and a molecular weight of 503.81 g/mol. Its IUPAC name is 2-[[(3R,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl N-ethylcarbamate.
| Compound Name | 2-[[(3R,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl N-ethylcarbamate |
|---|---|
| PubChem CID | 99575529 |
| Molecular Formula | C32H57NO3 |
| Molecular Weight | 503.81 g/mol |
| Exact Mass | 503.43 |
| IUPAC Name | 2-[[(3R,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCCO[C@@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@@H](C)CCCC(C)C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C32H57NO3/c1-7-33-30(34)36-20-19-35-25-15-17-31(5)24(21-25)11-12-26-28-14-13-27(23(4)10-8-9-22(2)3)32(28,6)18-16-29(26)31/h22-29H,7-21H2,1-6H3,(H,33,34)/t23-,24-,25+,26-,27+,28-,29-,31-,32+/m0/s1 |
| InChIKey | UGOXADCPGGLFMM-TXLCQXEFSA-N |
| XLogP | 8.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.81 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|