C29H48O3 — CID 118912467
[(1S,9S,13S,14R,17S)-1,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,5,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] methyl carbonate (PubChem CID 118912467) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is [(1S,9S,13S,14R,17S)-1,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,5,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] methyl carbonate.
| Compound Name | [(1S,9S,13S,14R,17S)-1,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,5,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 118912467 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | [(1S,9S,13S,14R,17S)-1,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,5,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] methyl carbonate |
| SMILES | COC(=O)OC1CC(C)C2C(C=CC3[C@H]2CC[C@]2(C)[C@@H]3CC[C@H]2C(C)CCCC(C)C)C1 |
| InChI | InChI=1S/C29H48O3/c1-18(2)8-7-9-19(3)25-12-13-26-23-11-10-21-17-22(32-28(30)31-6)16-20(4)27(21)24(23)14-15-29(25,26)5/h10-11,18-27H,7-9,12-17H2,1-6H3/t19?,20?,21?,22?,23?,24-,25+,26-,27?,29+/m1/s1 |
| InChIKey | RAOOMUWODNNIHD-NDGJWZLESA-N |
| XLogP | 7.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|