C30H52O3 — CID 10939487
(1R,5S,11E,13R,14S,17R,18R)-5-methoxy-2,18-dimethyl-17-[(2R)-6-methylheptan-2-yl]-8-oxatricyclo[11.7.0.014,18]icos-11-en-7-one (PubChem CID 10939487) has the molecular formula C30H52O3 and a molecular weight of 460.74 g/mol. Its IUPAC name is (1R,5S,11E,13R,14S,17R,18R)-5-methoxy-2,18-dimethyl-17-[(2R)-6-methylheptan-2-yl]-8-oxatricyclo[11.7.0.014,18]icos-11-en-7-one.
| Compound Name | (1R,5S,11E,13R,14S,17R,18R)-5-methoxy-2,18-dimethyl-17-[(2R)-6-methylheptan-2-yl]-8-oxatricyclo[11.7.0.014,18]icos-11-en-7-one |
|---|---|
| PubChem CID | 10939487 |
| Molecular Formula | C30H52O3 |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 460.39 |
| IUPAC Name | (1R,5S,11E,13R,14S,17R,18R)-5-methoxy-2,18-dimethyl-17-[(2R)-6-methylheptan-2-yl]-8-oxatricyclo[11.7.0.014,18]icos-11-en-7-one |
| SMILES | CO[C@H]1CCC(C)[C@H]2CC[C@]3(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]3[C@@H]2/C=C/CCOC(=O)C1 |
| InChI | InChI=1S/C30H52O3/c1-21(2)10-9-11-23(4)27-15-16-28-26-12-7-8-19-33-29(31)20-24(32-6)14-13-22(3)25(26)17-18-30(27,28)5/h7,12,21-28H,8-11,13-20H2,1-6H3/b12-7+/t22?,23-,24+,25-,26-,27-,28+,30-/m1/s1 |
| InChIKey | WUZXIWRDJPARFO-YDZAQYTQSA-N |
| XLogP | 7.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|