C27H42O2 — CID 23428235
(5R,8S,9S,10S,13R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,5,6,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-7,11-dione (PubChem CID 23428235) has the molecular formula C27H42O2 and a molecular weight of 398.63 g/mol. Its IUPAC name is (5R,8S,9S,10S,13R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,5,6,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-7,11-dione.
| Compound Name | (5R,8S,9S,10S,13R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,5,6,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-7,11-dione |
|---|---|
| PubChem CID | 23428235 |
| Molecular Formula | C27H42O2 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | (5R,8S,9S,10S,13R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,5,6,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-7,11-dione |
| SMILES | CC(C)CCC[C@H](C)C1CCC2[C@@H]3C(=O)C[C@@H]4C=CCC[C@]4(C)[C@H]3C(=O)C[C@]12C |
| InChI | InChI=1S/C27H42O2/c1-17(2)9-8-10-18(3)20-12-13-21-24-22(28)15-19-11-6-7-14-26(19,4)25(24)23(29)16-27(20,21)5/h6,11,17-21,24-25H,7-10,12-16H2,1-5H3/t18-,19-,20?,21?,24+,25-,26-,27+/m0/s1 |
| InChIKey | BNRSQZMASSKGII-SERVLDPLSA-N |
| XLogP | 6.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|