C29H48O2 — CID 175233549
(3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-2,3,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-one (PubChem CID 175233549) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is (3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-2,3,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-one.
| Compound Name | (3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-2,3,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 175233549 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | (3R,8S,9S,10R,13R,14S,17R)-3-hydroxy-4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-2,3,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-one |
| SMILES | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CC=C4C(C)(C)[C@H](O)CC[C@]4(C)[C@H]3C(=O)C[C@]12C |
| InChI | InChI=1S/C29H48O2/c1-18(2)9-8-10-19(3)21-12-13-22-20-11-14-24-27(4,5)25(31)15-16-28(24,6)26(20)23(30)17-29(21,22)7/h14,18-22,25-26,31H,8-13,15-17H2,1-7H3/t19?,20-,21+,22-,25+,26+,28-,29+/m0/s1 |
| InChIKey | LFQVXNNAXHNQRS-NUCJDWIRSA-N |
| XLogP | 7.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|