C29H48O2 — CID 20739664
(3R,8S,9S,10R,11S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]spiro[1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-4,1'-cyclopropane]-3,11-diol (PubChem CID 20739664) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is (3R,8S,9S,10R,11S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]spiro[1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-4,1'-cyclopropane]-3,11-diol.
| Compound Name | (3R,8S,9S,10R,11S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]spiro[1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-4,1'-cyclopropane]-3,11-diol |
|---|---|
| PubChem CID | 20739664 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | (3R,8S,9S,10R,11S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]spiro[1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-4,1'-cyclopropane]-3,11-diol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C5(CC5)[C@H](O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@]12C |
| InChI | InChI=1S/C29H48O2/c1-18(2)7-6-8-19(3)21-10-11-22-20-9-12-24-27(4,14-13-25(31)29(24)15-16-29)26(20)23(30)17-28(21,22)5/h12,18-23,25-26,30-31H,6-11,13-17H2,1-5H3/t19-,20+,21-,22+,23+,25-,26-,27+,28-/m1/s1 |
| InChIKey | KGTCKOLIGNUGAF-SGGZPYQMSA-N |
| XLogP | 6.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|