C27H44O3 — CID 98520062
(1R,2S,8S,11S,12S,15S,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-5-oxatetracyclo[9.7.0.02,8.012,16]octadecane-4,6-dione (PubChem CID 98520062) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is (1R,2S,8S,11S,12S,15S,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-5-oxatetracyclo[9.7.0.02,8.012,16]octadecane-4,6-dione.
| Compound Name | (1R,2S,8S,11S,12S,15S,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-5-oxatetracyclo[9.7.0.02,8.012,16]octadecane-4,6-dione |
|---|---|
| PubChem CID | 98520062 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | (1R,2S,8S,11S,12S,15S,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-5-oxatetracyclo[9.7.0.02,8.012,16]octadecane-4,6-dione |
| SMILES | CC(C)CCC[C@@H](C)[C@@H]1CC[C@H]2[C@H]3CC[C@H]4CC(=O)OC(=O)C[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C27H44O3/c1-17(2)7-6-8-18(3)21-11-12-22-20-10-9-19-15-24(28)30-25(29)16-27(19,5)23(20)13-14-26(21,22)4/h17-23H,6-16H2,1-5H3/t18-,19+,20-,21+,22+,23-,26-,27+/m1/s1 |
| InChIKey | WRMXUZMRKCNROQ-AZUOSWQVSA-N |
| XLogP | 6.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|