C27H44Br2O — CID 22212696
(8R,9S,10S,13R,14S,17R)-2,2-dibromo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 22212696) has the molecular formula C27H44Br2O and a molecular weight of 544.46 g/mol. Its IUPAC name is (8R,9S,10S,13R,14S,17R)-2,2-dibromo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10S,13R,14S,17R)-2,2-dibromo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 22212696 |
| Molecular Formula | C27H44Br2O |
| Molecular Weight | 544.46 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | (8R,9S,10S,13R,14S,17R)-2,2-dibromo-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CC(=O)C(Br)(Br)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H44Br2O/c1-17(2)7-6-8-18(3)21-11-12-22-20-10-9-19-15-24(30)27(28,29)16-26(19,5)23(20)13-14-25(21,22)4/h17-23H,6-16H2,1-5H3/t18-,19?,20+,21-,22+,23+,25-,26+/m1/s1 |
| InChIKey | MDLUKCYCPZKCEJ-BGQHZXLPSA-N |
| XLogP | 8.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.46 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|