C35H52N2O — CID 102490450
(1S,2S,5R,6R,9S,10R)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-19-phenyl-16,18-diazapentacyclo[11.8.0.02,10.05,9.015,20]henicos-15(20)-en-17-one (PubChem CID 102490450) has the molecular formula C35H52N2O and a molecular weight of 516.81 g/mol. Its IUPAC name is (1S,2S,5R,6R,9S,10R)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-19-phenyl-16,18-diazapentacyclo[11.8.0.02,10.05,9.015,20]henicos-15(20)-en-17-one.
| Compound Name | (1S,2S,5R,6R,9S,10R)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-19-phenyl-16,18-diazapentacyclo[11.8.0.02,10.05,9.015,20]henicos-15(20)-en-17-one |
|---|---|
| PubChem CID | 102490450 |
| Molecular Formula | C35H52N2O |
| Molecular Weight | 516.81 g/mol |
| Exact Mass | 516.41 |
| IUPAC Name | (1S,2S,5R,6R,9S,10R)-1,5-dimethyl-6-[(2R)-6-methylheptan-2-yl]-19-phenyl-16,18-diazapentacyclo[11.8.0.02,10.05,9.015,20]henicos-15(20)-en-17-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CC5=C(C[C@]4(C)[C@H]3CC[C@]12C)C(c1ccccc1)NC(=O)N5 |
| InChI | InChI=1S/C35H52N2O/c1-22(2)10-9-11-23(3)28-16-17-29-26-15-14-25-20-31-27(21-35(25,5)30(26)18-19-34(28,29)4)32(37-33(38)36-31)24-12-7-6-8-13-24/h6-8,12-13,22-23,25-26,28-30,32H,9-11,14-21H2,1-5H3,(H2,36,37,38)/t23-,25?,26+,28-,29+,30+,32?,34-,35+/m1/s1 |
| InChIKey | IDCUMFIQETTWSI-QSSCYSKPSA-N |
| XLogP | 9.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.81 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |