C34H50O — CID 134836667
(2E,10S,13R,17R)-2-benzylidene-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 134836667) has the molecular formula C34H50O and a molecular weight of 474.77 g/mol. Its IUPAC name is (2E,10S,13R,17R)-2-benzylidene-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (2E,10S,13R,17R)-2-benzylidene-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 134836667 |
| Molecular Formula | C34H50O |
| Molecular Weight | 474.77 g/mol |
| Exact Mass | 474.39 |
| IUPAC Name | (2E,10S,13R,17R)-2-benzylidene-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3CCC4CC(=O)/C(=C/c5ccccc5)C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C34H50O/c1-23(2)10-9-11-24(3)29-16-17-30-28-15-14-27-21-32(35)26(20-25-12-7-6-8-13-25)22-34(27,5)31(28)18-19-33(29,30)4/h6-8,12-13,20,23-24,27-31H,9-11,14-19,21-22H2,1-5H3/b26-20+/t24-,27?,28?,29-,30?,31?,33-,34+/m1/s1 |
| InChIKey | CZSQDAUGKJEDCI-IKWFKVRYSA-N |
| XLogP | 9.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.77 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|