C32H48O2 — CID 125031294
(2Z,5S,8R,9R,10S,13S,14R,17S)-2-(furan-2-ylmethylidene)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 125031294) has the molecular formula C32H48O2 and a molecular weight of 464.73 g/mol. Its IUPAC name is (2Z,5S,8R,9R,10S,13S,14R,17S)-2-(furan-2-ylmethylidene)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (2Z,5S,8R,9R,10S,13S,14R,17S)-2-(furan-2-ylmethylidene)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 125031294 |
| Molecular Formula | C32H48O2 |
| Molecular Weight | 464.73 g/mol |
| Exact Mass | 464.37 |
| IUPAC Name | (2Z,5S,8R,9R,10S,13S,14R,17S)-2-(furan-2-ylmethylidene)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)CCC[C@@H](C)[C@@H]1CC[C@@H]2[C@@H]3CC[C@H]4CC(=O)/C(=C\c5ccco5)C[C@]4(C)[C@@H]3CC[C@]21C |
| InChI | InChI=1S/C32H48O2/c1-21(2)8-6-9-22(3)27-13-14-28-26-12-11-24-19-30(33)23(18-25-10-7-17-34-25)20-32(24,5)29(26)15-16-31(27,28)4/h7,10,17-18,21-22,24,26-29H,6,8-9,11-16,19-20H2,1-5H3/b23-18-/t22-,24+,26+,27+,28-,29-,31+,32+/m1/s1 |
| InChIKey | NKKMYYCCSWYINI-VEYTZBFZSA-N |
| XLogP | 8.96 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.73 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|