C34H54N2O — CID 77156575
2-[(17-hept-5-en-2-yl-4,4,10,13-tetramethyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl)oxy]benzene-1,4-diamine (PubChem CID 77156575) has the molecular formula C34H54N2O and a molecular weight of 506.82 g/mol. Its IUPAC name is 2-[(17-hept-5-en-2-yl-4,4,10,13-tetramethyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl)oxy]benzene-1,4-diamine.
| Compound Name | 2-[(17-hept-5-en-2-yl-4,4,10,13-tetramethyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl)oxy]benzene-1,4-diamine |
|---|---|
| PubChem CID | 77156575 |
| Molecular Formula | C34H54N2O |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 506.42 |
| IUPAC Name | 2-[(17-hept-5-en-2-yl-4,4,10,13-tetramethyl-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl)oxy]benzene-1,4-diamine |
| SMILES | CC=CCCC(C)C1CCC2C3CCC4C(C)(C)C(Oc5cc(N)ccc5N)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C34H54N2O/c1-7-8-9-10-22(2)25-13-14-26-24-12-16-30-32(3,4)31(37-29-21-23(35)11-15-28(29)36)18-20-34(30,6)27(24)17-19-33(25,26)5/h7-8,11,15,21-22,24-27,30-31H,9-10,12-14,16-20,35-36H2,1-6H3 |
| InChIKey | VSGLWXLSDYKHBR-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|