C37H64N2O — CID 142281090
4-[(2,4-diaminophenyl)methyl]-4,10,13-trimethyl-17-(6-methylheptan-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol;ethane (PubChem CID 142281090) has the molecular formula C37H64N2O and a molecular weight of 552.93 g/mol. Its IUPAC name is 4-[(2,4-diaminophenyl)methyl]-4,10,13-trimethyl-17-(6-methylheptan-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol;ethane.
| Compound Name | 4-[(2,4-diaminophenyl)methyl]-4,10,13-trimethyl-17-(6-methylheptan-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol;ethane |
|---|---|
| PubChem CID | 142281090 |
| Molecular Formula | C37H64N2O |
| Molecular Weight | 552.93 g/mol |
| Exact Mass | 552.50 |
| IUPAC Name | 4-[(2,4-diaminophenyl)methyl]-4,10,13-trimethyl-17-(6-methylheptan-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol;ethane |
| SMILES | CC.CC(C)CCCC(C)C1CCC2C3CCC4C(C)(Cc5ccc(N)cc5N)C(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C35H58N2O.C2H6/c1-22(2)8-7-9-23(3)27-13-14-28-26-12-15-31-34(5,29(26)16-18-33(27,28)4)19-17-32(38)35(31,6)21-24-10-11-25(36)20-30(24)37;1-2/h10-11,20,22-23,26-29,31-32,38H,7-9,12-19,21,36-37H2,1-6H3;1-2H3 |
| InChIKey | QAPCRMBRXFZEFE-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.93 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|