C36H60N2O — CID 145268548
4-[[4-amino-2-(methylamino)phenyl]methyl]-4,10,13-trimethyl-17-(6-methylheptan-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 145268548) has the molecular formula C36H60N2O and a molecular weight of 536.89 g/mol. Its IUPAC name is 4-[[4-amino-2-(methylamino)phenyl]methyl]-4,10,13-trimethyl-17-(6-methylheptan-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | 4-[[4-amino-2-(methylamino)phenyl]methyl]-4,10,13-trimethyl-17-(6-methylheptan-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 145268548 |
| Molecular Formula | C36H60N2O |
| Molecular Weight | 536.89 g/mol |
| Exact Mass | 536.47 |
| IUPAC Name | 4-[[4-amino-2-(methylamino)phenyl]methyl]-4,10,13-trimethyl-17-(6-methylheptan-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CNc1cc(N)ccc1CC1(C)C(O)CCC2(C)C3CCC4(C)C(C(C)CCCC(C)C)CCC4C3CCC12 |
| InChI | InChI=1S/C36H60N2O/c1-23(2)9-8-10-24(3)28-14-15-29-27-13-16-32-35(5,30(27)17-19-34(28,29)4)20-18-33(39)36(32,6)22-25-11-12-26(37)21-31(25)38-7/h11-12,21,23-24,27-30,32-33,38-39H,8-10,13-20,22,37H2,1-7H3 |
| InChIKey | LKVZQINPCPFUPS-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.89 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|