C33H52N2O — CID 160814913
5-[[(8S,9S,10R,13R,14S,17R)-4,4,10,13-tetramethyl-17-[(2R)-pent-4-en-2-yl]-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxymethyl]benzene-1,3-diamine (PubChem CID 160814913) has the molecular formula C33H52N2O and a molecular weight of 492.79 g/mol. Its IUPAC name is 5-[[(8S,9S,10R,13R,14S,17R)-4,4,10,13-tetramethyl-17-[(2R)-pent-4-en-2-yl]-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxymethyl]benzene-1,3-diamine.
| Compound Name | 5-[[(8S,9S,10R,13R,14S,17R)-4,4,10,13-tetramethyl-17-[(2R)-pent-4-en-2-yl]-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxymethyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 160814913 |
| Molecular Formula | C33H52N2O |
| Molecular Weight | 492.79 g/mol |
| Exact Mass | 492.41 |
| IUPAC Name | 5-[[(8S,9S,10R,13R,14S,17R)-4,4,10,13-tetramethyl-17-[(2R)-pent-4-en-2-yl]-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxymethyl]benzene-1,3-diamine |
| SMILES | C=CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4C(C)(C)C(OCc5cc(N)cc(N)c5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H52N2O/c1-7-8-21(2)26-10-11-27-25-9-12-29-31(3,4)30(36-20-22-17-23(34)19-24(35)18-22)14-16-33(29,6)28(25)13-15-32(26,27)5/h7,17-19,21,25-30H,1,8-16,20,34-35H2,2-6H3/t21-,25+,26-,27+,28+,29?,30?,32-,33-/m1/s1 |
| InChIKey | UVGCUNSFMYCHHQ-AJHWLHQESA-N |
| XLogP | 8.24 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.79 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|