C39H64N2O4 — CID 118403304
(3,5-diaminophenyl)methyl 5-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-5-hydroperoxypentanoate (PubChem CID 118403304) has the molecular formula C39H64N2O4 and a molecular weight of 624.95 g/mol. Its IUPAC name is (3,5-diaminophenyl)methyl 5-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-5-hydroperoxypentanoate.
| Compound Name | (3,5-diaminophenyl)methyl 5-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-5-hydroperoxypentanoate |
|---|---|
| PubChem CID | 118403304 |
| Molecular Formula | C39H64N2O4 |
| Molecular Weight | 624.95 g/mol |
| Exact Mass | 624.49 |
| IUPAC Name | (3,5-diaminophenyl)methyl 5-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-5-hydroperoxypentanoate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CCC4CC(C(CCCC(=O)OCc5cc(N)cc(N)c5)OO)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C39H64N2O4/c1-25(2)8-6-9-26(3)33-14-15-34-32-13-12-29-22-28(16-18-38(29,4)35(32)17-19-39(33,34)5)36(45-43)10-7-11-37(42)44-24-27-20-30(40)23-31(41)21-27/h20-21,23,25-26,28-29,32-36,43H,6-19,22,24,40-41H2,1-5H3 |
| InChIKey | GFHAIURJCZLBTD-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.95 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|