C31H50N2O — CID 141204696
5-[[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxymethyl]benzene-1,3-diamine (PubChem CID 141204696) has the molecular formula C31H50N2O and a molecular weight of 466.75 g/mol. Its IUPAC name is 5-[[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxymethyl]benzene-1,3-diamine.
| Compound Name | 5-[[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxymethyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 141204696 |
| Molecular Formula | C31H50N2O |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.39 |
| IUPAC Name | 5-[[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxymethyl]benzene-1,3-diamine |
| SMILES | CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CC(OCc5cc(N)cc(N)c5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H50N2O/c1-5-6-20(2)27-9-10-28-26-8-7-22-17-25(34-19-21-15-23(32)18-24(33)16-21)11-13-30(22,3)29(26)12-14-31(27,28)4/h15-16,18,20,22,25-29H,5-14,17,19,32-33H2,1-4H3/t20-,22?,25?,26+,27-,28+,29+,30+,31-/m1/s1 |
| InChIKey | GDNDOLPLBZAYAQ-HGAXLDASSA-N |
| XLogP | 7.83 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|