C32H56O4 — CID 118403316
5-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-5-hydroperoxypentanoic acid (PubChem CID 118403316) has the molecular formula C32H56O4 and a molecular weight of 504.80 g/mol. Its IUPAC name is 5-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-5-hydroperoxypentanoic acid.
| Compound Name | 5-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-5-hydroperoxypentanoic acid |
|---|---|
| PubChem CID | 118403316 |
| Molecular Formula | C32H56O4 |
| Molecular Weight | 504.80 g/mol |
| Exact Mass | 504.42 |
| IUPAC Name | 5-[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-5-hydroperoxypentanoic acid |
| SMILES | CC(C)CCCC(C)C1CCC2C3CCC4CC(C(CCCC(=O)O)OO)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C32H56O4/c1-21(2)8-6-9-22(3)26-14-15-27-25-13-12-24-20-23(29(36-35)10-7-11-30(33)34)16-18-31(24,4)28(25)17-19-32(26,27)5/h21-29,35H,6-20H2,1-5H3,(H,33,34) |
| InChIKey | SYVHHDBOOZIODE-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.80 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|