C37H54N2O — CID 144803165
(3,5-diaminophenyl)-[16-ethyl-2,7-dimethyl-15-(6-methylhept-5-en-2-yl)-6-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-8-enyl]methanone (PubChem CID 144803165) has the molecular formula C37H54N2O and a molecular weight of 542.85 g/mol. Its IUPAC name is (3,5-diaminophenyl)-[16-ethyl-2,7-dimethyl-15-(6-methylhept-5-en-2-yl)-6-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-8-enyl]methanone.
| Compound Name | (3,5-diaminophenyl)-[16-ethyl-2,7-dimethyl-15-(6-methylhept-5-en-2-yl)-6-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-8-enyl]methanone |
|---|---|
| PubChem CID | 144803165 |
| Molecular Formula | C37H54N2O |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 542.42 |
| IUPAC Name | (3,5-diaminophenyl)-[16-ethyl-2,7-dimethyl-15-(6-methylhept-5-en-2-yl)-6-pentacyclo[9.7.0.02,8.05,7.012,16]octadec-8-enyl]methanone |
| SMILES | CCC12CCC3C(CC=C4C3(C)CCC3C(C(=O)c5cc(N)cc(N)c5)C43C)C1CCC2C(C)CCC=C(C)C |
| InChI | InChI=1S/C37H54N2O/c1-7-37-18-16-29-27(30(37)13-12-28(37)23(4)10-8-9-22(2)3)11-14-32-35(29,5)17-15-31-33(36(31,32)6)34(40)24-19-25(38)21-26(39)20-24/h9,14,19-21,23,27-31,33H,7-8,10-13,15-18,38-39H2,1-6H3 |
| InChIKey | VYPWUMPXNZHPQZ-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|