C20H32O4 — CID 11846141
ethyl 2-[(1S,3aS,4aR,6S,8aR,9aS)-1-acetyloxy-9a-methyl-1,2,3,3a,4,4a,5,6,7,8,8a,9-dodecahydrocyclopenta[b]naphthalen-6-yl]acetate (PubChem CID 11846141) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is ethyl 2-[(1S,3aS,4aR,6S,8aR,9aS)-1-acetyloxy-9a-methyl-1,2,3,3a,4,4a,5,6,7,8,8a,9-dodecahydrocyclopenta[b]naphthalen-6-yl]acetate.
| Compound Name | ethyl 2-[(1S,3aS,4aR,6S,8aR,9aS)-1-acetyloxy-9a-methyl-1,2,3,3a,4,4a,5,6,7,8,8a,9-dodecahydrocyclopenta[b]naphthalen-6-yl]acetate |
|---|---|
| PubChem CID | 11846141 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | ethyl 2-[(1S,3aS,4aR,6S,8aR,9aS)-1-acetyloxy-9a-methyl-1,2,3,3a,4,4a,5,6,7,8,8a,9-dodecahydrocyclopenta[b]naphthalen-6-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CC[C@@H]2C[C@@]3(C)[C@@H](CC[C@@H]3OC(C)=O)C[C@H]2C1 |
| InChI | InChI=1S/C20H32O4/c1-4-23-19(22)10-14-5-6-15-12-20(3)17(11-16(15)9-14)7-8-18(20)24-13(2)21/h14-18H,4-12H2,1-3H3/t14-,15+,16+,17-,18-,20-/m0/s1 |
| InChIKey | DZKBGUUJQAXTDC-URNBORRASA-N |
| XLogP | 4.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |