C23H35O4- — CID 11868676
2-[(3S,5S,8S,9R,10S,13S,14R,17S)-17-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]acetate (PubChem CID 11868676) has the molecular formula C23H35O4- and a molecular weight of 375.53 g/mol. Its IUPAC name is 2-[(3S,5S,8S,9R,10S,13S,14R,17S)-17-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]acetate.
| Compound Name | 2-[(3S,5S,8S,9R,10S,13S,14R,17S)-17-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]acetate |
|---|---|
| PubChem CID | 11868676 |
| Molecular Formula | C23H35O4- |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | 2-[(3S,5S,8S,9R,10S,13S,14R,17S)-17-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@H]2[C@H]3CC[C@H]4C[C@@H](CC(=O)[O-])CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C23H36O4/c1-14(24)27-20-7-6-18-17-5-4-16-12-15(13-21(25)26)8-10-22(16,2)19(17)9-11-23(18,20)3/h15-20H,4-13H2,1-3H3,(H,25,26)/p-1/t15-,16-,17+,18+,19+,20-,22-,23-/m0/s1 |
| InChIKey | ONYBRBPJVMVOCT-RHOYHYFJSA-M |
| XLogP | 3.72 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |