C20H31NO3 — CID 74972096
(9a,11a-dimethyl-8-oxo-1,2,3,3a,3b,4,5,5a,6,7,9,9b,10,11-tetradecahydroindeno[5,4-f]isoquinolin-1-yl) acetate (PubChem CID 74972096) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is (9a,11a-dimethyl-8-oxo-1,2,3,3a,3b,4,5,5a,6,7,9,9b,10,11-tetradecahydroindeno[5,4-f]isoquinolin-1-yl) acetate.
| Compound Name | (9a,11a-dimethyl-8-oxo-1,2,3,3a,3b,4,5,5a,6,7,9,9b,10,11-tetradecahydroindeno[5,4-f]isoquinolin-1-yl) acetate |
|---|---|
| PubChem CID | 74972096 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | (9a,11a-dimethyl-8-oxo-1,2,3,3a,3b,4,5,5a,6,7,9,9b,10,11-tetradecahydroindeno[5,4-f]isoquinolin-1-yl) acetate |
| SMILES | CC(=O)OC1CCC2C3CCC4CNC(=O)CC4(C)C3CCC12C |
| InChI | InChI=1S/C20H31NO3/c1-12(22)24-17-7-6-15-14-5-4-13-11-21-18(23)10-20(13,3)16(14)8-9-19(15,17)2/h13-17H,4-11H2,1-3H3,(H,21,23) |
| InChIKey | GIGHXLOIKKSZBP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |