C21H31N3O3 — CID 56654289
[(1S,5S,8R,9S,10S,13S,14S,17S)-1-azido-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 56654289) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is [(1S,5S,8R,9S,10S,13S,14S,17S)-1-azido-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(1S,5S,8R,9S,10S,13S,14S,17S)-1-azido-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 56654289 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | [(1S,5S,8R,9S,10S,13S,14S,17S)-1-azido-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H]3CC[C@H]4CC(=O)C[C@H](N=[N+]=[N-])[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H31N3O3/c1-12(25)27-19-7-6-16-15-5-4-13-10-14(26)11-18(23-24-22)21(13,3)17(15)8-9-20(16,19)2/h13,15-19H,4-11H2,1-3H3/t13-,15-,16-,17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | OTGFGZSFVCZFLW-RUGCIADISA-N |
| XLogP | 4.82 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|