C23H38O5 — CID 72745053
2,3-dihydroxypropyl 5-(2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl)-3-methylpentanoate (PubChem CID 72745053) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 5-(2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl)-3-methylpentanoate.
| Compound Name | 2,3-dihydroxypropyl 5-(2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl)-3-methylpentanoate |
|---|---|
| PubChem CID | 72745053 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 2,3-dihydroxypropyl 5-(2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl)-3-methylpentanoate |
| SMILES | CC1=C(CCC(C)CC(=O)OCC(O)CO)C2(C)CCCC(C)(C)C2CC1=O |
| InChI | InChI=1S/C23H38O5/c1-15(11-21(27)28-14-17(25)13-24)7-8-18-16(2)19(26)12-20-22(3,4)9-6-10-23(18,20)5/h15,17,20,24-25H,6-14H2,1-5H3 |
| InChIKey | DAERMAJVJZOUAC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |