C21H20O4 — CID 163007064
(4R,4aS,12bS)-4,12b-dimethyl-6,8,11-trioxo-2,3,4a,5-tetrahydro-1H-benzo[a]anthracene-4-carbaldehyde (PubChem CID 163007064) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is (4R,4aS,12bS)-4,12b-dimethyl-6,8,11-trioxo-2,3,4a,5-tetrahydro-1H-benzo[a]anthracene-4-carbaldehyde.
| Compound Name | (4R,4aS,12bS)-4,12b-dimethyl-6,8,11-trioxo-2,3,4a,5-tetrahydro-1H-benzo[a]anthracene-4-carbaldehyde |
|---|---|
| PubChem CID | 163007064 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (4R,4aS,12bS)-4,12b-dimethyl-6,8,11-trioxo-2,3,4a,5-tetrahydro-1H-benzo[a]anthracene-4-carbaldehyde |
| SMILES | C[C@@]1(C=O)CCC[C@]2(C)c3cc4c(cc3C(=O)C[C@H]12)C(=O)C=CC4=O |
| InChI | InChI=1S/C21H20O4/c1-20(11-22)6-3-7-21(2)15-9-13-12(16(23)4-5-17(13)24)8-14(15)18(25)10-19(20)21/h4-5,8-9,11,19H,3,6-7,10H2,1-2H3/t19-,20+,21-/m1/s1 |
| InChIKey | KLQSNFVWXFLFAS-QHAWAJNXSA-N |
| XLogP | 3.47 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|