C20H26O3 — CID 11099064
[(1R,4aS)-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-1-yl] formate (PubChem CID 11099064) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is [(1R,4aS)-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-1-yl] formate.
| Compound Name | [(1R,4aS)-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-1-yl] formate |
|---|---|
| PubChem CID | 11099064 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | [(1R,4aS)-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-1-yl] formate |
| SMILES | CC(C)c1ccc2c(c1)C(=O)CC1[C@](C)(OC=O)CCC[C@]21C |
| InChI | InChI=1S/C20H26O3/c1-13(2)14-6-7-16-15(10-14)17(22)11-18-19(16,3)8-5-9-20(18,4)23-12-21/h6-7,10,12-13,18H,5,8-9,11H2,1-4H3/t18?,19-,20-/m1/s1 |
| InChIKey | QPIVNAGNHBOZOZ-FXJNCMGBSA-N |
| XLogP | 4.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|