C21H27BrO3 — CID 92522923
methyl (1R,4aS,10R,10aS)-10-bromo-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate (PubChem CID 92522923) has the molecular formula C21H27BrO3 and a molecular weight of 407.35 g/mol. Its IUPAC name is methyl (1R,4aS,10R,10aS)-10-bromo-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aS,10R,10aS)-10-bromo-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 92522923 |
| Molecular Formula | C21H27BrO3 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | methyl (1R,4aS,10R,10aS)-10-bromo-1,4a-dimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)c3ccc(C(C)C)cc3C(=O)[C@H](Br)[C@H]12 |
| InChI | InChI=1S/C21H27BrO3/c1-12(2)13-7-8-15-14(11-13)17(23)16(22)18-20(15,3)9-6-10-21(18,4)19(24)25-5/h7-8,11-12,16,18H,6,9-10H2,1-5H3/t16-,18-,20+,21+/m0/s1 |
| InChIKey | UMARPJVAPXVBEX-XIGKFDRGSA-N |
| XLogP | 5.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|