C21H26O6 — CID 163092544
trimethyl (1R,4aR,9R,9aS)-1,4a-dimethyl-3,4,9,9a-tetrahydro-2H-fluorene-1,7,9-tricarboxylate (PubChem CID 163092544) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is trimethyl (1R,4aR,9R,9aS)-1,4a-dimethyl-3,4,9,9a-tetrahydro-2H-fluorene-1,7,9-tricarboxylate.
| Compound Name | trimethyl (1R,4aR,9R,9aS)-1,4a-dimethyl-3,4,9,9a-tetrahydro-2H-fluorene-1,7,9-tricarboxylate |
|---|---|
| PubChem CID | 163092544 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | trimethyl (1R,4aR,9R,9aS)-1,4a-dimethyl-3,4,9,9a-tetrahydro-2H-fluorene-1,7,9-tricarboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@H](C(=O)OC)[C@@H]1[C@](C)(C(=O)OC)CCC[C@@]21C |
| InChI | InChI=1S/C21H26O6/c1-20-9-6-10-21(2,19(24)27-5)16(20)15(18(23)26-4)13-11-12(17(22)25-3)7-8-14(13)20/h7-8,11,15-16H,6,9-10H2,1-5H3/t15-,16-,20-,21+/m0/s1 |
| InChIKey | YNEPSWZBQIGSBT-SNHGZMDHSA-N |
| XLogP | 2.98 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|