C19H26O4 — CID 163051770
methyl (4bR,8R,8aS,9R)-8,9-bis(hydroxymethyl)-4b,8-dimethyl-6,7,8a,9-tetrahydro-5H-fluorene-2-carboxylate (PubChem CID 163051770) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is methyl (4bR,8R,8aS,9R)-8,9-bis(hydroxymethyl)-4b,8-dimethyl-6,7,8a,9-tetrahydro-5H-fluorene-2-carboxylate.
| Compound Name | methyl (4bR,8R,8aS,9R)-8,9-bis(hydroxymethyl)-4b,8-dimethyl-6,7,8a,9-tetrahydro-5H-fluorene-2-carboxylate |
|---|---|
| PubChem CID | 163051770 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | methyl (4bR,8R,8aS,9R)-8,9-bis(hydroxymethyl)-4b,8-dimethyl-6,7,8a,9-tetrahydro-5H-fluorene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@H](CO)[C@@H]1[C@](C)(CO)CCC[C@@]21C |
| InChI | InChI=1S/C19H26O4/c1-18(11-21)7-4-8-19(2)15-6-5-12(17(22)23-3)9-13(15)14(10-20)16(18)19/h5-6,9,14,16,20-21H,4,7-8,10-11H2,1-3H3/t14-,16+,18-,19-/m0/s1 |
| InChIKey | YYRHWNBNLWJLRP-FXECBMLZSA-N |
| XLogP | 2.62 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |