C19H32O2 — CID 90068341
1,4a-dimethyl-5,6-di(propan-2-yl)-2,3,4,7,8,8a-hexahydronaphthalene-1-carboxylic acid (PubChem CID 90068341) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 1,4a-dimethyl-5,6-di(propan-2-yl)-2,3,4,7,8,8a-hexahydronaphthalene-1-carboxylic acid.
| Compound Name | 1,4a-dimethyl-5,6-di(propan-2-yl)-2,3,4,7,8,8a-hexahydronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 90068341 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 1,4a-dimethyl-5,6-di(propan-2-yl)-2,3,4,7,8,8a-hexahydronaphthalene-1-carboxylic acid |
| SMILES | CC(C)C1=C(C(C)C)C2(C)CCCC(C)(C(=O)O)C2CC1 |
| InChI | InChI=1S/C19H32O2/c1-12(2)14-8-9-15-18(5,16(14)13(3)4)10-7-11-19(15,6)17(20)21/h12-13,15H,7-11H2,1-6H3,(H,20,21) |
| InChIKey | DFDSKSDBZBPOMS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|