C16H20O2 — CID 132989043
(4aS,10aR)-6-hydroxy-4a,7-dimethyl-1,3,4,9,10,10a-hexahydrophenanthren-2-one (PubChem CID 132989043) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (4aS,10aR)-6-hydroxy-4a,7-dimethyl-1,3,4,9,10,10a-hexahydrophenanthren-2-one.
| Compound Name | (4aS,10aR)-6-hydroxy-4a,7-dimethyl-1,3,4,9,10,10a-hexahydrophenanthren-2-one |
|---|---|
| PubChem CID | 132989043 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (4aS,10aR)-6-hydroxy-4a,7-dimethyl-1,3,4,9,10,10a-hexahydrophenanthren-2-one |
| SMILES | Cc1cc2c(cc1O)[C@@]1(C)CCC(=O)C[C@H]1CC2 |
| InChI | InChI=1S/C16H20O2/c1-10-7-11-3-4-12-8-13(17)5-6-16(12,2)14(11)9-15(10)18/h7,9,12,18H,3-6,8H2,1-2H3/t12-,16+/m1/s1 |
| InChIKey | CBDLZRQBPRHLPM-WBMJQRKESA-N |
| XLogP | 3.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |