C20H29NO2 — CID 11336036
(4aS,10aS)-1,1,4a-trimethyl-8-nitro-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene (PubChem CID 11336036) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is (4aS,10aS)-1,1,4a-trimethyl-8-nitro-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene.
| Compound Name | (4aS,10aS)-1,1,4a-trimethyl-8-nitro-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene |
|---|---|
| PubChem CID | 11336036 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | (4aS,10aS)-1,1,4a-trimethyl-8-nitro-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene |
| SMILES | CC(C)c1ccc2c(c1[N+](=O)[O-])CC[C@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C20H29NO2/c1-13(2)14-7-9-16-15(18(14)21(22)23)8-10-17-19(3,4)11-6-12-20(16,17)5/h7,9,13,17H,6,8,10-12H2,1-5H3/t17-,20+/m0/s1 |
| InChIKey | LQGVRMOYOAHJPR-FXAWDEMLSA-N |
| XLogP | 5.75 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|