C21H32O3 — CID 145196060
(2S,4aS,9S)-9-methoxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-2,6-diol (PubChem CID 145196060) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (2S,4aS,9S)-9-methoxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-2,6-diol.
| Compound Name | (2S,4aS,9S)-9-methoxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-2,6-diol |
|---|---|
| PubChem CID | 145196060 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (2S,4aS,9S)-9-methoxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-2,6-diol |
| SMILES | CO[C@H]1CC2C(C)(C)[C@@H](O)CC[C@]2(C)c2cc(O)c(C(C)C)cc21 |
| InChI | InChI=1S/C21H32O3/c1-12(2)13-9-14-15(10-16(13)22)21(5)8-7-19(23)20(3,4)18(21)11-17(14)24-6/h9-10,12,17-19,22-23H,7-8,11H2,1-6H3/t17-,18?,19-,21+/m0/s1 |
| InChIKey | JGRYVZFXUAEMRG-BRIHBJQLSA-N |
| XLogP | 4.66 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |