C20H30O3 — CID 101274446
(4bR,8aS,10R)-4b-(hydroxymethyl)-8,8-dimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-3,10-diol (PubChem CID 101274446) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (4bR,8aS,10R)-4b-(hydroxymethyl)-8,8-dimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-3,10-diol.
| Compound Name | (4bR,8aS,10R)-4b-(hydroxymethyl)-8,8-dimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-3,10-diol |
|---|---|
| PubChem CID | 101274446 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (4bR,8aS,10R)-4b-(hydroxymethyl)-8,8-dimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-3,10-diol |
| SMILES | CC(C)c1cc2c(cc1O)[C@@]1(CO)CCCC(C)(C)[C@@H]1C[C@H]2O |
| InChI | InChI=1S/C20H30O3/c1-12(2)13-8-14-15(9-16(13)22)20(11-21)7-5-6-19(3,4)18(20)10-17(14)23/h8-9,12,17-18,21-23H,5-7,10-11H2,1-4H3/t17-,18+,20+/m1/s1 |
| InChIKey | MNMRBYHDUZJXFI-HBFSDRIKSA-N |
| XLogP | 4.01 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |