C21H30O — CID 162853466
4b,7,8,8-tetramethyl-2-propan-2-yl-5,6,7,8a-tetrahydrophenanthren-3-ol (PubChem CID 162853466) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is 4b,7,8,8-tetramethyl-2-propan-2-yl-5,6,7,8a-tetrahydrophenanthren-3-ol.
| Compound Name | 4b,7,8,8-tetramethyl-2-propan-2-yl-5,6,7,8a-tetrahydrophenanthren-3-ol |
|---|---|
| PubChem CID | 162853466 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 4b,7,8,8-tetramethyl-2-propan-2-yl-5,6,7,8a-tetrahydrophenanthren-3-ol |
| SMILES | CC(C)c1cc2c(cc1O)C1(C)CCC(C)C(C)(C)C1C=C2 |
| InChI | InChI=1S/C21H30O/c1-13(2)16-11-15-7-8-19-20(4,5)14(3)9-10-21(19,6)17(15)12-18(16)22/h7-8,11-14,19,22H,9-10H2,1-6H3 |
| InChIKey | ZKCPEUHGNUEUIZ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |