C19H26O3 — CID 145196031
(10R)-6,10-dihydroxy-1,4a-dimethyl-7-propan-2-yl-1,2,3,4,10,10a-hexahydrophenanthren-9-one (PubChem CID 145196031) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (10R)-6,10-dihydroxy-1,4a-dimethyl-7-propan-2-yl-1,2,3,4,10,10a-hexahydrophenanthren-9-one.
| Compound Name | (10R)-6,10-dihydroxy-1,4a-dimethyl-7-propan-2-yl-1,2,3,4,10,10a-hexahydrophenanthren-9-one |
|---|---|
| PubChem CID | 145196031 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (10R)-6,10-dihydroxy-1,4a-dimethyl-7-propan-2-yl-1,2,3,4,10,10a-hexahydrophenanthren-9-one |
| SMILES | CC(C)c1cc2c(cc1O)C1(C)CCCC(C)C1[C@@H](O)C2=O |
| InChI | InChI=1S/C19H26O3/c1-10(2)12-8-13-14(9-15(12)20)19(4)7-5-6-11(3)16(19)18(22)17(13)21/h8-11,16,18,20,22H,5-7H2,1-4H3/t11?,16?,18-,19?/m1/s1 |
| InChIKey | JKMZFPYHNSMIJY-VYOCIKGGSA-N |
| XLogP | 3.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |