C20H22O4 — CID 11244281
(1R,12R)-4-hydroxy-1,12-dimethyl-5-propan-2-yl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,9(16)-tetraene-8,11-dione (PubChem CID 11244281) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is (1R,12R)-4-hydroxy-1,12-dimethyl-5-propan-2-yl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,9(16)-tetraene-8,11-dione.
| Compound Name | (1R,12R)-4-hydroxy-1,12-dimethyl-5-propan-2-yl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,9(16)-tetraene-8,11-dione |
|---|---|
| PubChem CID | 11244281 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (1R,12R)-4-hydroxy-1,12-dimethyl-5-propan-2-yl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,9(16)-tetraene-8,11-dione |
| SMILES | CC(C)c1cc2c(cc1O)[C@@]1(C)CCC[C@@]3(C)C(=O)OC(=C31)C2=O |
| InChI | InChI=1S/C20H22O4/c1-10(2)11-8-12-13(9-14(11)21)19(3)6-5-7-20(4)17(19)16(15(12)22)24-18(20)23/h8-10,21H,5-7H2,1-4H3/t19-,20-/m1/s1 |
| InChIKey | AXGGCYIGMFOQQW-WOJBJXKFSA-N |
| XLogP | 3.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |