C20H28 — CID 10934481
(4aS,10aS)-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,10a-tetrahydrophenanthrene (PubChem CID 10934481) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is (4aS,10aS)-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,10a-tetrahydrophenanthrene.
| Compound Name | (4aS,10aS)-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,10a-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 10934481 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | (4aS,10aS)-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,10a-tetrahydrophenanthrene |
| SMILES | CC(C)c1ccc2c(c1)C=C[C@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C20H28/c1-14(2)15-7-9-17-16(13-15)8-10-18-19(3,4)11-6-12-20(17,18)5/h7-10,13-14,18H,6,11-12H2,1-5H3/t18-,20+/m0/s1 |
| InChIKey | YVNLHHYRZHOWQE-AZUAARDMSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |