C22H32O3 — CID 170851321
acetic acid;(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a-tetrahydrophenanthren-2-ol (PubChem CID 170851321) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is acetic acid;(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a-tetrahydrophenanthren-2-ol.
| Compound Name | acetic acid;(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a-tetrahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 170851321 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | acetic acid;(4bS,8aS)-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a-tetrahydrophenanthren-2-ol |
| SMILES | CC(=O)O.CC(C)c1c(O)ccc2c1C=C[C@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C20H28O.C2H4O2/c1-13(2)18-14-7-10-17-19(3,4)11-6-12-20(17,5)15(14)8-9-16(18)21;1-2(3)4/h7-10,13,17,21H,6,11-12H2,1-5H3;1H3,(H,3,4)/t17-,20+;/m0./s1 |
| InChIKey | PDZDNNGGQWNSOS-YFUYRHFLSA-N |
| XLogP | 5.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |