C23H34O4 — CID 71436782
acetic acid;10-methoxy-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a-tetrahydrophenanthren-2-ol (PubChem CID 71436782) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is acetic acid;10-methoxy-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a-tetrahydrophenanthren-2-ol.
| Compound Name | acetic acid;10-methoxy-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a-tetrahydrophenanthren-2-ol |
|---|---|
| PubChem CID | 71436782 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | acetic acid;10-methoxy-4b,8,8-trimethyl-1-propan-2-yl-5,6,7,8a-tetrahydrophenanthren-2-ol |
| SMILES | CC(=O)O.COC1=CC2C(C)(C)CCCC2(C)c2ccc(O)c(C(C)C)c21 |
| InChI | InChI=1S/C21H30O2.C2H4O2/c1-13(2)18-15(22)9-8-14-19(18)16(23-6)12-17-20(3,4)10-7-11-21(14,17)5;1-2(3)4/h8-9,12-13,17,22H,7,10-11H2,1-6H3;1H3,(H,3,4) |
| InChIKey | BCJCQLNHXBJOKN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |